C16H14ClNO5 — CID 151041504
N-(5-chloro-2-methoxyphenyl)-N-(2-oxooxolan-3-yl)furan-2-carboxamide (PubChem CID 151041504) has the molecular formula C16H14ClNO5 and a molecular weight of 335.74 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-N-(2-oxooxolan-3-yl)furan-2-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-N-(2-oxooxolan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 151041504 |
| Molecular Formula | C16H14ClNO5 |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-N-(2-oxooxolan-3-yl)furan-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1N(C(=O)c1ccco1)C1CCOC1=O |
| InChI | InChI=1S/C16H14ClNO5/c1-21-13-5-4-10(17)9-12(13)18(11-6-8-23-16(11)20)15(19)14-3-2-7-22-14/h2-5,7,9,11H,6,8H2,1H3 |
| InChIKey | MCEJWRIFTKAINZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |