C18H14N2O3 — CID 151052010
4-[3-(4-methyl-1H-benzimidazol-2-yl)-3-oxoprop-1-enyl]benzoic acid (PubChem CID 151052010) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-[3-(4-methyl-1H-benzimidazol-2-yl)-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[3-(4-methyl-1H-benzimidazol-2-yl)-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 151052010 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[3-(4-methyl-1H-benzimidazol-2-yl)-3-oxoprop-1-enyl]benzoic acid |
| SMILES | Cc1cccc2[nH]c(C(=O)C=Cc3ccc(C(=O)O)cc3)nc12 |
| InChI | InChI=1S/C18H14N2O3/c1-11-3-2-4-14-16(11)20-17(19-14)15(21)10-7-12-5-8-13(9-6-12)18(22)23/h2-10H,1H3,(H,19,20)(H,22,23) |
| InChIKey | MEIBSVLZLQBLLM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|