C23H29F3O5S2 — CID 151054955
[2-(4,7-dibutoxynaphthalen-1-yl)thiolan-2-yl] trifluoromethanesulfonate (PubChem CID 151054955) has the molecular formula C23H29F3O5S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is [2-(4,7-dibutoxynaphthalen-1-yl)thiolan-2-yl] trifluoromethanesulfonate.
| Compound Name | [2-(4,7-dibutoxynaphthalen-1-yl)thiolan-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 151054955 |
| Molecular Formula | C23H29F3O5S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | [2-(4,7-dibutoxynaphthalen-1-yl)thiolan-2-yl] trifluoromethanesulfonate |
| SMILES | CCCCOc1ccc2c(OCCCC)ccc(C3(OS(=O)(=O)C(F)(F)F)CCCS3)c2c1 |
| InChI | InChI=1S/C23H29F3O5S2/c1-3-5-13-29-17-8-9-18-19(16-17)20(10-11-21(18)30-14-6-4-2)22(12-7-15-32-22)31-33(27,28)23(24,25)26/h8-11,16H,3-7,12-15H2,1-2H3 |
| InChIKey | MEXNBKYPPFZEPF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|