C19H22Cl2N2O — CID 151068715
2,4-bis[2-(aminomethyl)-5-chlorophenyl]pentan-3-one (PubChem CID 151068715) has the molecular formula C19H22Cl2N2O and a molecular weight of 365.30 g/mol. Its IUPAC name is 2,4-bis[2-(aminomethyl)-5-chlorophenyl]pentan-3-one.
| Compound Name | 2,4-bis[2-(aminomethyl)-5-chlorophenyl]pentan-3-one |
|---|---|
| PubChem CID | 151068715 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2,4-bis[2-(aminomethyl)-5-chlorophenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1cc(Cl)ccc1CN)c1cc(Cl)ccc1CN |
| InChI | InChI=1S/C19H22Cl2N2O/c1-11(17-7-15(20)5-3-13(17)9-22)19(24)12(2)18-8-16(21)6-4-14(18)10-23/h3-8,11-12H,9-10,22-23H2,1-2H3 |
| InChIKey | MHRFCSBGPUYMOH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |