C11H16ClNOS — CID 114864987
3-[2-(aminomethyl)-5-chlorophenyl]sulfanylbutan-1-ol (PubChem CID 114864987) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-5-chlorophenyl]sulfanylbutan-1-ol.
| Compound Name | 3-[2-(aminomethyl)-5-chlorophenyl]sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 114864987 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-[2-(aminomethyl)-5-chlorophenyl]sulfanylbutan-1-ol |
| SMILES | CC(CCO)Sc1cc(Cl)ccc1CN |
| InChI | InChI=1S/C11H16ClNOS/c1-8(4-5-14)15-11-6-10(12)3-2-9(11)7-13/h2-3,6,8,14H,4-5,7,13H2,1H3 |
| InChIKey | UOMJSRACTFQHET-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |