C11H9ClFIN6O — CID 151069045
N-(2-amino-6-chloro-5-iodopyrimidin-4-yl)-2-(3-fluoro-2-pyridinyl)acetohydrazide (PubChem CID 151069045) has the molecular formula C11H9ClFIN6O and a molecular weight of 422.59 g/mol. Its IUPAC name is N-(2-amino-6-chloro-5-iodopyrimidin-4-yl)-2-(3-fluoro-2-pyridinyl)acetohydrazide.
| Compound Name | N-(2-amino-6-chloro-5-iodopyrimidin-4-yl)-2-(3-fluoro-2-pyridinyl)acetohydrazide |
|---|---|
| PubChem CID | 151069045 |
| Molecular Formula | C11H9ClFIN6O |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | N-(2-amino-6-chloro-5-iodopyrimidin-4-yl)-2-(3-fluoro-2-pyridinyl)acetohydrazide |
| SMILES | Nc1nc(Cl)c(I)c(N(N)C(=O)Cc2ncccc2F)n1 |
| InChI | InChI=1S/C11H9ClFIN6O/c12-9-8(14)10(19-11(15)18-9)20(16)7(21)4-6-5(13)2-1-3-17-6/h1-3H,4,16H2,(H2,15,18,19) |
| InChIKey | MHSXAIVPBOKBGM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|