C13H11N5O2 — CID 15108255
4-[(5-amino-6-cyanopyrazin-2-yl)-methylamino]benzoic acid (PubChem CID 15108255) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-[(5-amino-6-cyanopyrazin-2-yl)-methylamino]benzoic acid.
| Compound Name | 4-[(5-amino-6-cyanopyrazin-2-yl)-methylamino]benzoic acid |
|---|---|
| PubChem CID | 15108255 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[(5-amino-6-cyanopyrazin-2-yl)-methylamino]benzoic acid |
| SMILES | CN(c1ccc(C(=O)O)cc1)c1cnc(N)c(C#N)n1 |
| InChI | InChI=1S/C13H11N5O2/c1-18(9-4-2-8(3-5-9)13(19)20)11-7-16-12(15)10(6-14)17-11/h2-5,7H,1H3,(H2,15,16)(H,19,20) |
| InChIKey | NFLNVRMSSGRVKA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |