C6H5Cl2NO2 — CID 151099471
6,6-dichloro-1H-pyridine-3-carboxylic acid (PubChem CID 151099471) has the molecular formula C6H5Cl2NO2 and a molecular weight of 194.02 g/mol. Its IUPAC name is 6,6-dichloro-1H-pyridine-3-carboxylic acid.
| Compound Name | 6,6-dichloro-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 151099471 |
| Molecular Formula | C6H5Cl2NO2 |
| Molecular Weight | 194.02 g/mol |
| Exact Mass | 192.97 |
| IUPAC Name | 6,6-dichloro-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)C1=CNC(Cl)(Cl)C=C1 |
| InChI | InChI=1S/C6H5Cl2NO2/c7-6(8)2-1-4(3-9-6)5(10)11/h1-3,9H,(H,10,11) |
| InChIKey | MNUWYQFTWQFUMX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.02 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|