C23H34FN3O — CID 151102231
2-[2-fluoro-4-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]-8-oxa-2-azaspiro[4.5]decane (PubChem CID 151102231) has the molecular formula C23H34FN3O and a molecular weight of 387.54 g/mol. Its IUPAC name is 2-[2-fluoro-4-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]-8-oxa-2-azaspiro[4.5]decane.
| Compound Name | 2-[2-fluoro-4-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]-8-oxa-2-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 151102231 |
| Molecular Formula | C23H34FN3O |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 2-[2-fluoro-4-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]-8-oxa-2-azaspiro[4.5]decane |
| SMILES | C[C@H]1CCCN1[C@H]1CCN(c2ccc(N3CCC4(CCOCC4)C3)c(F)c2)C1 |
| InChI | InChI=1S/C23H34FN3O/c1-18-3-2-10-27(18)20-6-11-25(16-20)19-4-5-22(21(24)15-19)26-12-7-23(17-26)8-13-28-14-9-23/h4-5,15,18,20H,2-3,6-14,16-17H2,1H3/t18-,20-/m0/s1 |
| InChIKey | MOJBITUGZGKVHJ-ICSRJNTNSA-N |
| XLogP | 3.90 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|