C23H36ClN3O — CID 71293965
6-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]-2-(oxan-4-yl)-3,4-dihydro-1H-isoquinoline;hydrochloride (PubChem CID 71293965) has the molecular formula C23H36ClN3O and a molecular weight of 406.01 g/mol. Its IUPAC name is 6-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]-2-(oxan-4-yl)-3,4-dihydro-1H-isoquinoline;hydrochloride.
| Compound Name | 6-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]-2-(oxan-4-yl)-3,4-dihydro-1H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 71293965 |
| Molecular Formula | C23H36ClN3O |
| Molecular Weight | 406.01 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 6-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]-2-(oxan-4-yl)-3,4-dihydro-1H-isoquinoline;hydrochloride |
| SMILES | C[C@H]1CCCN1[C@H]1CCN(c2ccc3c(c2)CCN(C2CCOCC2)C3)C1.Cl |
| InChI | InChI=1S/C23H35N3O.ClH/c1-18-3-2-10-26(18)23-7-12-25(17-23)22-5-4-20-16-24(11-6-19(20)15-22)21-8-13-27-14-9-21;/h4-5,15,18,21,23H,2-3,6-14,16-17H2,1H3;1H/t18-,23-;/m0./s1 |
| InChIKey | BUWYTQISCAZLLZ-JCNFZFLDSA-N |
| XLogP | 3.71 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.01 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|