C25H30FN3O — CID 54596902
(4-fluorophenyl)-[6-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 54596902) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is (4-fluorophenyl)-[6-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | (4-fluorophenyl)-[6-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 54596902 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | (4-fluorophenyl)-[6-[(3S)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | C[C@H]1CCCN1[C@H]1CCN(c2ccc3c(c2)CCN(C(=O)c2ccc(F)cc2)C3)C1 |
| InChI | InChI=1S/C25H30FN3O/c1-18-3-2-12-29(18)24-11-14-27(17-24)23-9-6-21-16-28(13-10-20(21)15-23)25(30)19-4-7-22(26)8-5-19/h4-9,15,18,24H,2-3,10-14,16-17H2,1H3/t18-,24-/m0/s1 |
| InChIKey | OHRDZNVXIPJCFY-UUOWRZLLSA-N |
| XLogP | 4.09 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|