C13H18N2O — CID 166120622
2-(oxolan-3-yl)-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 166120622) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-3,4-dihydro-1H-isoquinolin-6-amine.
| Compound Name | 2-(oxolan-3-yl)-3,4-dihydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 166120622 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-(oxolan-3-yl)-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | Nc1ccc2c(c1)CCN(C1CCOC1)C2 |
| InChI | InChI=1S/C13H18N2O/c14-12-2-1-11-8-15(5-3-10(11)7-12)13-4-6-16-9-13/h1-2,7,13H,3-6,8-9,14H2 |
| InChIKey | VEZQZAHHOQFBRA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|