C22H33N3O3 — CID 67403663
oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate (PubChem CID 67403663) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate.
| Compound Name | oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 67403663 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate |
| SMILES | Cc1cc(NC(=O)OC2CCOCC2)ccc1N1CCC(N2CCCC2C)C1 |
| InChI | InChI=1S/C22H33N3O3/c1-16-14-18(23-22(26)28-20-8-12-27-13-9-20)5-6-21(16)24-11-7-19(15-24)25-10-3-4-17(25)2/h5-6,14,17,19-20H,3-4,7-13,15H2,1-2H3,(H,23,26) |
| InChIKey | INQUHXRLHOELQK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|