About oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate
oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate (PubChem CID 67403663) has the molecular formula C22H33N3O3
and a molecular weight of 387.52 g/mol. Its IUPAC name is oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate.
Molecular Properties
| Compound Name | oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate |
| PubChem CID | 67403663 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate |
| SMILES | Cc1cc(NC(=O)OC2CCOCC2)ccc1N1CCC(N2CCCC2C)C1 |
| InChI | InChI=1S/C22H33N3O3/c1-16-14-18(23-22(26)28-20-8-12-27-13-9-20)5-6-21(16)24-11-7-19(15-24)25-10-3-4-17(25)2/h5-6,14,17,19-20H,3-4,7-13,15H2,1-2H3,(H,23,26) |
| InChIKey | INQUHXRLHOELQK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate?
The IUPAC name of oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate (CID 67403663) is oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate.
What is the SMILES notation for oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate?
The canonical SMILES for oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate is Cc1cc(NC(=O)OC2CCOCC2)ccc1N1CCC(N2CCCC2C)C1.
What is the InChIKey of oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate?
The InChIKey is INQUHXRLHOELQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33N3O3/c1-16-14-18(23-22(26)28-20-8-12-27-13-9-20)5-6-21(16)24-11-7-19(15-24)25-10-3-4-17(25)2/h5-6,14,17,19-20H,3-4,7-13,15H2,1-2H3,(H,23,26).
What are the key properties of oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate?
oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate has a molecular weight of 387.52 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate is sourced from PubChem (CID 67403663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).