C27H30F3N3O3 — CID 67401581
N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-3-phenylprop-2-ynamide;2,2,2-trifluoroacetic acid (PubChem CID 67401581) has the molecular formula C27H30F3N3O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-3-phenylprop-2-ynamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-3-phenylprop-2-ynamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67401581 |
| Molecular Formula | C27H30F3N3O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-3-phenylprop-2-ynamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(NC(=O)C#Cc2ccccc2)ccc1N1CCC(N2CCCC2C)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H29N3O.C2HF3O2/c1-19-17-22(26-25(29)13-10-21-8-4-3-5-9-21)11-12-24(19)27-16-14-23(18-27)28-15-6-7-20(28)2;3-2(4,5)1(6)7/h3-5,8-9,11-12,17,20,23H,6-7,14-16,18H2,1-2H3,(H,26,29);(H,6,7) |
| InChIKey | ZZYRHMLISRXPBB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|