C26H38F3N3O3 — CID 66625137
2,2,3,3-tetramethyl-N-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 66625137) has the molecular formula C26H38F3N3O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2,2,3,3-tetramethyl-N-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66625137 |
| Molecular Formula | C26H38F3N3O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 2,2,3,3-tetramethyl-N-[2-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(N2CCC(N3CCCC3C)C2)ccc1NC(=O)C1C(C)(C)C1(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H37N3O.C2HF3O2/c1-16-14-18(26-13-11-19(15-26)27-12-7-8-17(27)2)9-10-20(16)25-22(28)21-23(3,4)24(21,5)6;3-2(4,5)1(6)7/h9-10,14,17,19,21H,7-8,11-13,15H2,1-6H3,(H,25,28);(H,6,7) |
| InChIKey | IUDJFMMCKFOICU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|