C23H37N5O2 — CID 67136314
(4-ethylpiperazin-1-yl) N-[2-methyl-4-[(3R)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]carbamate (PubChem CID 67136314) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl) N-[2-methyl-4-[(3R)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]carbamate.
| Compound Name | (4-ethylpiperazin-1-yl) N-[2-methyl-4-[(3R)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 67136314 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | (4-ethylpiperazin-1-yl) N-[2-methyl-4-[(3R)-3-[(2S)-2-methylpyrrolidin-1-yl]pyrrolidin-1-yl]phenyl]carbamate |
| SMILES | CCN1CCN(OC(=O)Nc2ccc(N3CC[C@@H](N4CCC[C@@H]4C)C3)cc2C)CC1 |
| InChI | InChI=1S/C23H37N5O2/c1-4-25-12-14-27(15-13-25)30-23(29)24-22-8-7-20(16-18(22)2)26-11-9-21(17-26)28-10-5-6-19(28)3/h7-8,16,19,21H,4-6,9-15,17H2,1-3H3,(H,24,29)/t19-,21+/m0/s1 |
| InChIKey | KBBOCNCRCWPDLZ-PZJWPPBQSA-N |
| XLogP | 3.16 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|