C25H34N4O — CID 59401894
3-(dimethylamino)-N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]benzamide (PubChem CID 59401894) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 59401894 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 3-(dimethylamino)-N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(N(C)C)c2)ccc1N1CCC(N2CCCC2C)C1 |
| InChI | InChI=1S/C25H34N4O/c1-18-15-21(26-25(30)20-8-5-9-22(16-20)27(3)4)10-11-24(18)28-14-12-23(17-28)29-13-6-7-19(29)2/h5,8-11,15-16,19,23H,6-7,12-14,17H2,1-4H3,(H,26,30) |
| InChIKey | HPLIKJDUHCEQDN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|