C21H29N5O2 — CID 67405231
(5-methyl-1H-pyrazol-3-yl) N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate (PubChem CID 67405231) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is (5-methyl-1H-pyrazol-3-yl) N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate.
| Compound Name | (5-methyl-1H-pyrazol-3-yl) N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 67405231 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (5-methyl-1H-pyrazol-3-yl) N-[3-methyl-4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]carbamate |
| SMILES | Cc1cc(OC(=O)Nc2ccc(N3CCC(N4CCCC4C)C3)c(C)c2)n[nH]1 |
| InChI | InChI=1S/C21H29N5O2/c1-14-11-17(22-21(27)28-20-12-15(2)23-24-20)6-7-19(14)25-10-8-18(13-25)26-9-4-5-16(26)3/h6-7,11-12,16,18H,4-5,8-10,13H2,1-3H3,(H,22,27)(H,23,24) |
| InChIKey | HHPWPORVCGGJAK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|