C24H26Cl2F3N3O3 — CID 67401170
3,5-dichloro-N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 67401170) has the molecular formula C24H26Cl2F3N3O3 and a molecular weight of 532.39 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3,5-dichloro-N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67401170 |
| Molecular Formula | C24H26Cl2F3N3O3 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 3,5-dichloro-N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCCN1C1CCN(c2ccc(NC(=O)c3cc(Cl)cc(Cl)c3)cc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H25Cl2N3O.C2HF3O2/c1-15-3-2-9-27(15)21-8-10-26(14-21)20-6-4-19(5-7-20)25-22(28)16-11-17(23)13-18(24)12-16;3-2(4,5)1(6)7/h4-7,11-13,15,21H,2-3,8-10,14H2,1H3,(H,25,28);(H,6,7) |
| InChIKey | CELVDKRAEUYCJW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|