About 2-octan-4-yloxypropanoic acid
2-octan-4-yloxypropanoic acid (PubChem CID 151104523) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-octan-4-yloxypropanoic acid.
Molecular Properties
| Compound Name | 2-octan-4-yloxypropanoic acid |
| PubChem CID | 151104523 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-octan-4-yloxypropanoic acid |
| SMILES | CCCCC(CCC)OC(C)C(=O)O |
| InChI | InChI=1S/C11H22O3/c1-4-6-8-10(7-5-2)14-9(3)11(12)13/h9-10H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | MOUZSDIEARZMBY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-octan-4-yloxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octan-4-yloxypropanoic acid?
The IUPAC name of 2-octan-4-yloxypropanoic acid (CID 151104523) is 2-octan-4-yloxypropanoic acid.
What is the SMILES notation for 2-octan-4-yloxypropanoic acid?
The canonical SMILES for 2-octan-4-yloxypropanoic acid is CCCCC(CCC)OC(C)C(=O)O.
What is the InChIKey of 2-octan-4-yloxypropanoic acid?
The InChIKey is MOUZSDIEARZMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-4-6-8-10(7-5-2)14-9(3)11(12)13/h9-10H,4-8H2,1-3H3,(H,12,13).
What are the key properties of 2-octan-4-yloxypropanoic acid?
2-octan-4-yloxypropanoic acid has a molecular weight of 202.29 g/mol, XLogP of 2.84, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octan-4-yloxypropanoic acid is sourced from PubChem (CID 151104523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).