C8H12N2S — CID 15110477
2-piperidin-1-yl-1,3-thiazole (PubChem CID 15110477) has the molecular formula C8H12N2S and a molecular weight of 168.27 g/mol. Its IUPAC name is 2-piperidin-1-yl-1,3-thiazole.
| Compound Name | 2-piperidin-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 15110477 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.27 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 2-piperidin-1-yl-1,3-thiazole |
| SMILES | c1csc(N2CCCCC2)n1 |
| InChI | InChI=1S/C8H12N2S/c1-2-5-10(6-3-1)8-9-4-7-11-8/h4,7H,1-3,5-6H2 |
| InChIKey | XSHHZEANTJNOHO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |