C9H8O2 — CID 15110645
2-methylbicyclo[4.2.0]octa-1(6),3-diene-7,8-dione (PubChem CID 15110645) has the molecular formula C9H8O2 and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-methylbicyclo[4.2.0]octa-1(6),3-diene-7,8-dione.
| Compound Name | 2-methylbicyclo[4.2.0]octa-1(6),3-diene-7,8-dione |
|---|---|
| PubChem CID | 15110645 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 2-methylbicyclo[4.2.0]octa-1(6),3-diene-7,8-dione |
| SMILES | CC1C=CCc2c1c(=O)c2=O |
| InChI | InChI=1S/C9H8O2/c1-5-3-2-4-6-7(5)9(11)8(6)10/h2-3,5H,4H2,1H3 |
| InChIKey | ZWSULLQNUZKSHB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|