About 9-(6-iodohexyl)carbazole
9-(6-iodohexyl)carbazole (PubChem CID 15110912) has the molecular formula C18H20IN
and a molecular weight of 377.27 g/mol. Its IUPAC name is 9-(6-iodohexyl)carbazole.
Molecular Properties
| Compound Name | 9-(6-iodohexyl)carbazole |
| PubChem CID | 15110912 |
| Molecular Formula | C18H20IN |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 9-(6-iodohexyl)carbazole |
| SMILES | ICCCCCCn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C18H20IN/c19-13-7-1-2-8-14-20-17-11-5-3-9-15(17)16-10-4-6-12-18(16)20/h3-6,9-12H,1-2,7-8,13-14H2 |
| InChIKey | RRRVSJBXHQVZEG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-(6-iodohexyl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(6-iodohexyl)carbazole?
The IUPAC name of 9-(6-iodohexyl)carbazole (CID 15110912) is 9-(6-iodohexyl)carbazole.
What is the SMILES notation for 9-(6-iodohexyl)carbazole?
The canonical SMILES for 9-(6-iodohexyl)carbazole is ICCCCCCn1c2ccccc2c2ccccc21.
What is the InChIKey of 9-(6-iodohexyl)carbazole?
The InChIKey is RRRVSJBXHQVZEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20IN/c19-13-7-1-2-8-14-20-17-11-5-3-9-15(17)16-10-4-6-12-18(16)20/h3-6,9-12H,1-2,7-8,13-14H2.
What are the key properties of 9-(6-iodohexyl)carbazole?
9-(6-iodohexyl)carbazole has a molecular weight of 377.27 g/mol, XLogP of 5.79, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(6-iodohexyl)carbazole is sourced from PubChem (CID 15110912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).