C27H32N2O4 — CID 151111758
ethyl (2R)-2-methyl-3-oxo-3-[(5R)-2-oxo-5-phenyl-3,9-diazaspiro[5.5]undecan-9-yl]-2-phenylpropanoate (PubChem CID 151111758) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is ethyl (2R)-2-methyl-3-oxo-3-[(5R)-2-oxo-5-phenyl-3,9-diazaspiro[5.5]undecan-9-yl]-2-phenylpropanoate.
| Compound Name | ethyl (2R)-2-methyl-3-oxo-3-[(5R)-2-oxo-5-phenyl-3,9-diazaspiro[5.5]undecan-9-yl]-2-phenylpropanoate |
|---|---|
| PubChem CID | 151111758 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | ethyl (2R)-2-methyl-3-oxo-3-[(5R)-2-oxo-5-phenyl-3,9-diazaspiro[5.5]undecan-9-yl]-2-phenylpropanoate |
| SMILES | CCOC(=O)[C@@](C)(C(=O)N1CCC2(CC1)CC(=O)NC[C@H]2c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32N2O4/c1-3-33-25(32)26(2,21-12-8-5-9-13-21)24(31)29-16-14-27(15-17-29)18-23(30)28-19-22(27)20-10-6-4-7-11-20/h4-13,22H,3,14-19H2,1-2H3,(H,28,30)/t22-,26+/m0/s1 |
| InChIKey | MQGXKZRKMTZNQP-BKMJKUGQSA-N |
| XLogP | 3.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|