C25H28F3N3O3 — CID 151394267
(5R)-5-(2-aminophenyl)-9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3,9-diazaspiro[5.5]undecan-2-one (PubChem CID 151394267) has the molecular formula C25H28F3N3O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is (5R)-5-(2-aminophenyl)-9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3,9-diazaspiro[5.5]undecan-2-one.
| Compound Name | (5R)-5-(2-aminophenyl)-9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3,9-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 151394267 |
| Molecular Formula | C25H28F3N3O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (5R)-5-(2-aminophenyl)-9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3,9-diazaspiro[5.5]undecan-2-one |
| SMILES | CO[C@@](C(=O)N1CCC2(CC1)CC(=O)NC[C@H]2c1ccccc1N)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H28F3N3O3/c1-34-24(25(26,27)28,17-7-3-2-4-8-17)22(33)31-13-11-23(12-14-31)15-21(32)30-16-19(23)18-9-5-6-10-20(18)29/h2-10,19H,11-16,29H2,1H3,(H,30,32)/t19-,24+/m0/s1 |
| InChIKey | OVCLUMJXYVZIQH-YADARESESA-N |
| XLogP | 3.59 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|