About 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane
5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane (PubChem CID 151119437) has the molecular formula C28H58O2
and a molecular weight of 426.77 g/mol. Its IUPAC name is 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane.
Molecular Properties
| Compound Name | 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane |
| PubChem CID | 151119437 |
| Molecular Formula | C28H58O2 |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 426.44 |
| IUPAC Name | 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane |
| SMILES | CCCCCCCCC(CC(CC)CCCC)C(CC(CC)CCCC)(OC)OC |
| InChI | InChI=1S/C28H58O2/c1-8-13-16-17-18-19-22-27(23-25(11-4)20-14-9-2)28(29-6,30-7)24-26(12-5)21-15-10-3/h25-27H,8-24H2,1-7H3 |
| InChIKey | MRWIZFDNEVZJII-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane?
The IUPAC name of 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane (CID 151119437) is 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane.
What is the SMILES notation for 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane?
The canonical SMILES for 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane is CCCCCCCCC(CC(CC)CCCC)C(CC(CC)CCCC)(OC)OC.
What is the InChIKey of 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane?
The InChIKey is MRWIZFDNEVZJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H58O2/c1-8-13-16-17-18-19-22-27(23-25(11-4)20-14-9-2)28(29-6,30-7)24-26(12-5)21-15-10-3/h25-27H,8-24H2,1-7H3.
What are the key properties of 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane?
5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane has a molecular weight of 426.77 g/mol, XLogP of 9.56, 22 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-8-(2-ethylhexyl)-7,7-dimethoxyhexadecane is sourced from PubChem (CID 151119437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).