C19H18FN — CID 151120083
3-(3-fluorophenyl)spiro[cyclohexane-1,3'-indole] (PubChem CID 151120083) has the molecular formula C19H18FN and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-(3-fluorophenyl)spiro[cyclohexane-1,3'-indole].
| Compound Name | 3-(3-fluorophenyl)spiro[cyclohexane-1,3'-indole] |
|---|---|
| PubChem CID | 151120083 |
| Molecular Formula | C19H18FN |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-(3-fluorophenyl)spiro[cyclohexane-1,3'-indole] |
| SMILES | Fc1cccc(C2CCCC3(C=Nc4ccccc43)C2)c1 |
| InChI | InChI=1S/C19H18FN/c20-16-7-3-5-14(11-16)15-6-4-10-19(12-15)13-21-18-9-2-1-8-17(18)19/h1-3,5,7-9,11,13,15H,4,6,10,12H2 |
| InChIKey | MRZMQBNTPDJCDV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |