C21H17N3O7 — CID 151136324
2-[5-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-2-nitrophenyl]propanedioic acid (PubChem CID 151136324) has the molecular formula C21H17N3O7 and a molecular weight of 423.38 g/mol. Its IUPAC name is 2-[5-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-2-nitrophenyl]propanedioic acid.
| Compound Name | 2-[5-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-2-nitrophenyl]propanedioic acid |
|---|---|
| PubChem CID | 151136324 |
| Molecular Formula | C21H17N3O7 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[5-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-2-nitrophenyl]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)c1cc(C(O)CC2c3ccccc3-c3cncn32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N3O7/c25-18(8-16-12-3-1-2-4-13(12)17-9-22-10-23(16)17)11-5-6-15(24(30)31)14(7-11)19(20(26)27)21(28)29/h1-7,9-10,16,18-19,25H,8H2,(H,26,27)(H,28,29) |
| InChIKey | MVGYXUDOLJNWBF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|