C18H16N4O — CID 118857926
4-[2-(5H-imidazo[5,1-a]isoindol-5-yl)-1-nitrosoethyl]aniline (PubChem CID 118857926) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-[2-(5H-imidazo[5,1-a]isoindol-5-yl)-1-nitrosoethyl]aniline.
| Compound Name | 4-[2-(5H-imidazo[5,1-a]isoindol-5-yl)-1-nitrosoethyl]aniline |
|---|---|
| PubChem CID | 118857926 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-[2-(5H-imidazo[5,1-a]isoindol-5-yl)-1-nitrosoethyl]aniline |
| SMILES | Nc1ccc(C(CC2c3ccccc3-c3cncn32)N=O)cc1 |
| InChI | InChI=1S/C18H16N4O/c19-13-7-5-12(6-8-13)16(21-23)9-17-14-3-1-2-4-15(14)18-10-20-11-22(17)18/h1-8,10-11,16-17H,9,19H2 |
| InChIKey | GKEQAPDXRIRLCY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|