C15H13N3OS — CID 70874895
2-(5H-imidazo[5,1-a]isoindol-5-yl)-1-(1,3-thiazol-5-yl)ethanol (PubChem CID 70874895) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-(5H-imidazo[5,1-a]isoindol-5-yl)-1-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 2-(5H-imidazo[5,1-a]isoindol-5-yl)-1-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 70874895 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(5H-imidazo[5,1-a]isoindol-5-yl)-1-(1,3-thiazol-5-yl)ethanol |
| SMILES | OC(CC1c2ccccc2-c2cncn21)c1cncs1 |
| InChI | InChI=1S/C15H13N3OS/c19-14(15-7-17-9-20-15)5-12-10-3-1-2-4-11(10)13-6-16-8-18(12)13/h1-4,6-9,12,14,19H,5H2 |
| InChIKey | XGPDPODYEGNQHX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |