C18H14O — CID 151141354
5,10-dimethylindeno[2,1-a]inden-1-ol (PubChem CID 151141354) has the molecular formula C18H14O and a molecular weight of 246.31 g/mol. Its IUPAC name is 5,10-dimethylindeno[2,1-a]inden-1-ol.
| Compound Name | 5,10-dimethylindeno[2,1-a]inden-1-ol |
|---|---|
| PubChem CID | 151141354 |
| Molecular Formula | C18H14O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5,10-dimethylindeno[2,1-a]inden-1-ol |
| SMILES | CC1=C2C(=C(C)c3c(O)cccc32)c2ccccc21 |
| InChI | InChI=1S/C18H14O/c1-10-12-6-3-4-7-13(12)18-11(2)16-14(17(10)18)8-5-9-15(16)19/h3-9,19H,1-2H3 |
| InChIKey | MWGRPHLWADRWIP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|