C20H24N2O4 — CID 151145236
(3S)-3-amino-4-[2-(3-methoxyphenyl)ethylamino]-2-oxo-5-phenylpentanoic acid (PubChem CID 151145236) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (3S)-3-amino-4-[2-(3-methoxyphenyl)ethylamino]-2-oxo-5-phenylpentanoic acid.
| Compound Name | (3S)-3-amino-4-[2-(3-methoxyphenyl)ethylamino]-2-oxo-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 151145236 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (3S)-3-amino-4-[2-(3-methoxyphenyl)ethylamino]-2-oxo-5-phenylpentanoic acid |
| SMILES | COc1cccc(CCNC(Cc2ccccc2)[C@H](N)C(=O)C(=O)O)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-26-16-9-5-8-15(12-16)10-11-22-17(18(21)19(23)20(24)25)13-14-6-3-2-4-7-14/h2-9,12,17-18,22H,10-11,13,21H2,1H3,(H,24,25)/t17?,18-/m0/s1 |
| InChIKey | MXBBJIJERIPGQM-ZVAWYAOSSA-N |
| XLogP | 1.42 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|