C3H8N2O6PS- — CID 151151649
1-oxo-2-(phosphonomethylamino)-1-(sulfinatoamino)ethane (PubChem CID 151151649) has the molecular formula C3H8N2O6PS- and a molecular weight of 231.15 g/mol. Its IUPAC name is 1-oxo-2-(phosphonomethylamino)-1-(sulfinatoamino)ethane.
| Compound Name | 1-oxo-2-(phosphonomethylamino)-1-(sulfinatoamino)ethane |
|---|---|
| PubChem CID | 151151649 |
| Molecular Formula | C3H8N2O6PS- |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 1-oxo-2-(phosphonomethylamino)-1-(sulfinatoamino)ethane |
| SMILES | O=C(CNCP(=O)(O)O)NS(=O)[O-] |
| InChI | InChI=1S/C3H9N2O6PS/c6-3(5-13(10)11)1-4-2-12(7,8)9/h4H,1-2H2,(H,5,6)(H,10,11)(H2,7,8,9)/p-1 |
| InChIKey | RWYALFZTYJRRFC-UHFFFAOYSA-M |
| XLogP | -2.38 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|