C19H43N2O5P — CID 121334190
2-(phosphonomethylamino)acetate;tetrabutylazanium (PubChem CID 121334190) has the molecular formula C19H43N2O5P and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-(phosphonomethylamino)acetate;tetrabutylazanium.
| Compound Name | 2-(phosphonomethylamino)acetate;tetrabutylazanium |
|---|---|
| PubChem CID | 121334190 |
| Molecular Formula | C19H43N2O5P |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 2-(phosphonomethylamino)acetate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])CNCP(=O)(O)O |
| InChI | InChI=1S/C16H36N.C3H8NO5P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;5-3(6)1-4-2-10(7,8)9/h5-16H2,1-4H3;4H,1-2H2,(H,5,6)(H2,7,8,9)/q+1;/p-1 |
| InChIKey | JLJPKUDCMKHUBV-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|