C14H18N2O2S — CID 15116364
S-[(3S,5S)-5-(benzylcarbamoyl)pyrrolidin-3-yl] ethanethioate (PubChem CID 15116364) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is S-[(3S,5S)-5-(benzylcarbamoyl)pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[(3S,5S)-5-(benzylcarbamoyl)pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 15116364 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | S-[(3S,5S)-5-(benzylcarbamoyl)pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H]1CN[C@H](C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C14H18N2O2S/c1-10(17)19-12-7-13(15-9-12)14(18)16-8-11-5-3-2-4-6-11/h2-6,12-13,15H,7-9H2,1H3,(H,16,18)/t12-,13-/m0/s1 |
| InChIKey | HCQRVJOVBGXTJS-STQMWFEESA-N |
| XLogP | 1.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|