About 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone
1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone (PubChem CID 151166340) has the molecular formula C16H21Cl3O
and a molecular weight of 335.70 g/mol. Its IUPAC name is 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone.
Molecular Properties
| Compound Name | 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone |
| PubChem CID | 151166340 |
| Molecular Formula | C16H21Cl3O |
| Molecular Weight | 335.70 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone |
| SMILES | CCCCc1cc(C(C)(C)C)ccc1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H21Cl3O/c1-5-6-7-11-10-12(15(2,3)4)8-9-13(11)14(20)16(17,18)19/h8-10H,5-7H2,1-4H3 |
| InChIKey | NBIFIKPUJXBKRP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone?
The IUPAC name of 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone (CID 151166340) is 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone.
What is the SMILES notation for 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone?
The canonical SMILES for 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone is CCCCc1cc(C(C)(C)C)ccc1C(=O)C(Cl)(Cl)Cl.
What is the InChIKey of 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone?
The InChIKey is NBIFIKPUJXBKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl3O/c1-5-6-7-11-10-12(15(2,3)4)8-9-13(11)14(20)16(17,18)19/h8-10H,5-7H2,1-4H3.
What are the key properties of 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone?
1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone has a molecular weight of 335.70 g/mol, XLogP of 5.88, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone is sourced from PubChem (CID 151166340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).