C16H21Cl3O — CID 151166340
1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone (PubChem CID 151166340) has the molecular formula C16H21Cl3O and a molecular weight of 335.70 g/mol. Its IUPAC name is 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone.
| Compound Name | 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone |
|---|---|
| PubChem CID | 151166340 |
| Molecular Formula | C16H21Cl3O |
| Molecular Weight | 335.70 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-(2-butyl-4-tert-butylphenyl)-2,2,2-trichloroethanone |
| SMILES | CCCCc1cc(C(C)(C)C)ccc1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H21Cl3O/c1-5-6-7-11-10-12(15(2,3)4)8-9-13(11)14(20)16(17,18)19/h8-10H,5-7H2,1-4H3 |
| InChIKey | NBIFIKPUJXBKRP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|