C28H32N6O9 — CID 151170909
2-[1-amino-2-(5-cyano-2-methoxyphenoxy)-6-[3-(dimethylcarbamoyl)-5-methoxyphenoxy]-5-nitro-2H-pyrimidin-4-yl]-3-methylpentanoic acid (PubChem CID 151170909) has the molecular formula C28H32N6O9 and a molecular weight of 596.60 g/mol. Its IUPAC name is 2-[1-amino-2-(5-cyano-2-methoxyphenoxy)-6-[3-(dimethylcarbamoyl)-5-methoxyphenoxy]-5-nitro-2H-pyrimidin-4-yl]-3-methylpentanoic acid.
| Compound Name | 2-[1-amino-2-(5-cyano-2-methoxyphenoxy)-6-[3-(dimethylcarbamoyl)-5-methoxyphenoxy]-5-nitro-2H-pyrimidin-4-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 151170909 |
| Molecular Formula | C28H32N6O9 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 2-[1-amino-2-(5-cyano-2-methoxyphenoxy)-6-[3-(dimethylcarbamoyl)-5-methoxyphenoxy]-5-nitro-2H-pyrimidin-4-yl]-3-methylpentanoic acid |
| SMILES | CCC(C)C(C(=O)O)C1=NC(Oc2cc(C#N)ccc2OC)N(N)C(Oc2cc(OC)cc(C(=O)N(C)C)c2)=C1[N+](=O)[O-] |
| InChI | InChI=1S/C28H32N6O9/c1-7-15(2)22(27(36)37)23-24(34(38)39)26(42-19-12-17(25(35)32(3)4)11-18(13-19)40-5)33(30)28(31-23)43-21-10-16(14-29)8-9-20(21)41-6/h8-13,15,22,28H,7,30H2,1-6H3,(H,36,37) |
| InChIKey | NCGBCCIIPOPEBU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 203.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|