C31H27N5O9 — CID 54004808
ethyl 2-[6-(5-cyano-2-phenylmethoxyphenoxy)-2-[3-(dimethylcarbamoyl)phenoxy]-5-nitropyrimidin-4-yl]oxyacetate (PubChem CID 54004808) has the molecular formula C31H27N5O9 and a molecular weight of 613.58 g/mol. Its IUPAC name is ethyl 2-[6-(5-cyano-2-phenylmethoxyphenoxy)-2-[3-(dimethylcarbamoyl)phenoxy]-5-nitropyrimidin-4-yl]oxyacetate.
| Compound Name | ethyl 2-[6-(5-cyano-2-phenylmethoxyphenoxy)-2-[3-(dimethylcarbamoyl)phenoxy]-5-nitropyrimidin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 54004808 |
| Molecular Formula | C31H27N5O9 |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | ethyl 2-[6-(5-cyano-2-phenylmethoxyphenoxy)-2-[3-(dimethylcarbamoyl)phenoxy]-5-nitropyrimidin-4-yl]oxyacetate |
| SMILES | CCOC(=O)COc1nc(Oc2cccc(C(=O)N(C)C)c2)nc(Oc2cc(C#N)ccc2OCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C31H27N5O9/c1-4-41-26(37)19-43-28-27(36(39)40)29(34-31(33-28)44-23-12-8-11-22(16-23)30(38)35(2)3)45-25-15-21(17-32)13-14-24(25)42-18-20-9-6-5-7-10-20/h5-16H,4,18-19H2,1-3H3 |
| InChIKey | KOCMSTFSGYWULG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 176.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|