C30H33N7O7 — CID 22103086
ethyl 2-[2-(2-tert-butyl-5-cyanophenoxy)-6-[3-(4,5-dihydro-1H-imidazol-2-yl)-5-(dimethylamino)phenoxy]-5-nitropyrimidin-4-yl]oxyacetate (PubChem CID 22103086) has the molecular formula C30H33N7O7 and a molecular weight of 603.64 g/mol. Its IUPAC name is ethyl 2-[2-(2-tert-butyl-5-cyanophenoxy)-6-[3-(4,5-dihydro-1H-imidazol-2-yl)-5-(dimethylamino)phenoxy]-5-nitropyrimidin-4-yl]oxyacetate.
| Compound Name | ethyl 2-[2-(2-tert-butyl-5-cyanophenoxy)-6-[3-(4,5-dihydro-1H-imidazol-2-yl)-5-(dimethylamino)phenoxy]-5-nitropyrimidin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 22103086 |
| Molecular Formula | C30H33N7O7 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | ethyl 2-[2-(2-tert-butyl-5-cyanophenoxy)-6-[3-(4,5-dihydro-1H-imidazol-2-yl)-5-(dimethylamino)phenoxy]-5-nitropyrimidin-4-yl]oxyacetate |
| SMILES | CCOC(=O)COc1nc(Oc2cc(C#N)ccc2C(C)(C)C)nc(Oc2cc(C3=NCCN3)cc(N(C)C)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C30H33N7O7/c1-7-41-24(38)17-42-27-25(37(39)40)28(43-21-14-19(26-32-10-11-33-26)13-20(15-21)36(5)6)35-29(34-27)44-23-12-18(16-31)8-9-22(23)30(2,3)4/h8-9,12-15H,7,10-11,17H2,1-6H3,(H,32,33) |
| InChIKey | ASCGUTOOWXDRDS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 174.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|