C30H28N8O4 — CID 18916657
3-[6-(benzylamino)-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-(dimethylamino)benzonitrile (PubChem CID 18916657) has the molecular formula C30H28N8O4 and a molecular weight of 564.61 g/mol. Its IUPAC name is 3-[6-(benzylamino)-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-(dimethylamino)benzonitrile.
| Compound Name | 3-[6-(benzylamino)-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-(dimethylamino)benzonitrile |
|---|---|
| PubChem CID | 18916657 |
| Molecular Formula | C30H28N8O4 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 3-[6-(benzylamino)-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-(dimethylamino)benzonitrile |
| SMILES | CN1CCN=C1c1cccc(Oc2nc(NCc3ccccc3)c([N+](=O)[O-])c(Oc3cc(C#N)ccc3N(C)C)n2)c1 |
| InChI | InChI=1S/C30H28N8O4/c1-36(2)24-13-12-21(18-31)16-25(24)42-29-26(38(39)40)27(33-19-20-8-5-4-6-9-20)34-30(35-29)41-23-11-7-10-22(17-23)28-32-14-15-37(28)3/h4-13,16-17H,14-15,19H2,1-3H3,(H,33,34,35) |
| InChIKey | NOEXIDHFNMJTBH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|