C31H23N7O6 — CID 18916737
[3-[4-(benzylamino)-6-(3-cyano-5-phenoxyphenoxy)-5-nitropyrimidin-2-yl]oxyphenyl]urea (PubChem CID 18916737) has the molecular formula C31H23N7O6 and a molecular weight of 589.57 g/mol. Its IUPAC name is [3-[4-(benzylamino)-6-(3-cyano-5-phenoxyphenoxy)-5-nitropyrimidin-2-yl]oxyphenyl]urea.
| Compound Name | [3-[4-(benzylamino)-6-(3-cyano-5-phenoxyphenoxy)-5-nitropyrimidin-2-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 18916737 |
| Molecular Formula | C31H23N7O6 |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | [3-[4-(benzylamino)-6-(3-cyano-5-phenoxyphenoxy)-5-nitropyrimidin-2-yl]oxyphenyl]urea |
| SMILES | N#Cc1cc(Oc2ccccc2)cc(Oc2nc(Oc3cccc(NC(N)=O)c3)nc(NCc3ccccc3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H23N7O6/c32-18-21-14-25(42-23-11-5-2-6-12-23)17-26(15-21)43-29-27(38(40)41)28(34-19-20-8-3-1-4-9-20)36-31(37-29)44-24-13-7-10-22(16-24)35-30(33)39/h1-17H,19H2,(H3,33,35,39)(H,34,36,37) |
| InChIKey | ICJIYRRKMVYXPA-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 187.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|