About [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea
[3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea (PubChem CID 141042225) has the molecular formula C26H18N6O5
and a molecular weight of 494.47 g/mol. Its IUPAC name is [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea.
Molecular Properties
| Compound Name | [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea |
| PubChem CID | 141042225 |
| Molecular Formula | C26H18N6O5 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea |
| SMILES | N#Cc1cc(Oc2ccccc2)cc(Oc2nc(Oc3cccc(NC(N)=O)c3)nc3c2NC=CO3)c1 |
| InChI | InChI=1S/C26H18N6O5/c27-15-16-11-20(35-18-6-2-1-3-7-18)14-21(12-16)36-24-22-23(34-10-9-29-22)31-26(32-24)37-19-8-4-5-17(13-19)30-25(28)33/h1-14,29H,(H3,28,30,33) |
| InChIKey | YSAHDMRYHZPKEN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea?
The IUPAC name of [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea (CID 141042225) is [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea.
What is the SMILES notation for [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea?
The canonical SMILES for [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea is N#Cc1cc(Oc2ccccc2)cc(Oc2nc(Oc3cccc(NC(N)=O)c3)nc3c2NC=CO3)c1.
What is the InChIKey of [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea?
The InChIKey is YSAHDMRYHZPKEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18N6O5/c27-15-16-11-20(35-18-6-2-1-3-7-18)14-21(12-16)36-24-22-23(34-10-9-29-22)31-26(32-24)37-19-8-4-5-17(13-19)30-25(28)33/h1-14,29H,(H3,28,30,33).
What are the key properties of [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea?
[3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea has a molecular weight of 494.47 g/mol, XLogP of 5.49, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[4-(3-cyano-5-phenoxyphenoxy)-5H-pyrimido[4,5-b][1,4]oxazin-2-yl]oxy]phenyl]urea is sourced from PubChem (CID 141042225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).