C28H26N7O4+ — CID 123170962
[amino-[3-[[2-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-6-yl]oxy]-5-phenoxyphenyl]methylidene]azanium (PubChem CID 123170962) has the molecular formula C28H26N7O4+ and a molecular weight of 524.56 g/mol. Its IUPAC name is [amino-[3-[[2-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-6-yl]oxy]-5-phenoxyphenyl]methylidene]azanium.
| Compound Name | [amino-[3-[[2-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-6-yl]oxy]-5-phenoxyphenyl]methylidene]azanium |
|---|---|
| PubChem CID | 123170962 |
| Molecular Formula | C28H26N7O4+ |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | [amino-[3-[[2-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-6-yl]oxy]-5-phenoxyphenyl]methylidene]azanium |
| SMILES | Cc1nc2nc(Oc3cccc(C(=O)N(C)C)c3)nc(Oc3cc(Oc4ccccc4)cc(C(N)=[NH2+])c3)c2[nH]1 |
| InChI | InChI=1S/C28H25N7O4/c1-16-31-23-25(32-16)33-28(39-20-11-7-8-17(12-20)27(36)35(2)3)34-26(23)38-22-14-18(24(29)30)13-21(15-22)37-19-9-5-4-6-10-19/h4-15H,1-3H3,(H3,29,30)(H,31,32,33,34)/p+1 |
| InChIKey | SIHBKRKAJKMDIR-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 154.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|