C23H24N7O3+ — CID 123304746
[amino-[3-[[2-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-6-yl]oxy]-4-methylphenyl]methylidene]azanium (PubChem CID 123304746) has the molecular formula C23H24N7O3+ and a molecular weight of 446.49 g/mol. Its IUPAC name is [amino-[3-[[2-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-6-yl]oxy]-4-methylphenyl]methylidene]azanium.
| Compound Name | [amino-[3-[[2-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-6-yl]oxy]-4-methylphenyl]methylidene]azanium |
|---|---|
| PubChem CID | 123304746 |
| Molecular Formula | C23H24N7O3+ |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [amino-[3-[[2-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-6-yl]oxy]-4-methylphenyl]methylidene]azanium |
| SMILES | Cc1nc2nc(Oc3cccc(C(=O)N(C)C)c3)nc(Oc3cc(C(N)=[NH2+])ccc3C)c2[nH]1 |
| InChI | InChI=1S/C23H23N7O3/c1-12-8-9-14(19(24)25)11-17(12)33-21-18-20(27-13(2)26-18)28-23(29-21)32-16-7-5-6-15(10-16)22(31)30(3)4/h5-11H,1-4H3,(H3,24,25)(H,26,27,28,29)/p+1 |
| InChIKey | PVNMHNPHDCNYSI-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|