C23H21N7O5 — CID 18916742
4-carbamimidoyl-2-[[6-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-2-yl]oxy]benzoic acid (PubChem CID 18916742) has the molecular formula C23H21N7O5 and a molecular weight of 475.47 g/mol. Its IUPAC name is 4-carbamimidoyl-2-[[6-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-2-yl]oxy]benzoic acid.
| Compound Name | 4-carbamimidoyl-2-[[6-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-2-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 18916742 |
| Molecular Formula | C23H21N7O5 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-carbamimidoyl-2-[[6-[3-(dimethylcarbamoyl)phenoxy]-8-methyl-7H-purin-2-yl]oxy]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)O)c(Oc2nc(Oc3cccc(C(=O)N(C)C)c3)c3[nH]c(C)nc3n2)c1 |
| InChI | InChI=1S/C23H21N7O5/c1-11-26-17-19(27-11)28-23(35-16-10-12(18(24)25)7-8-15(16)22(32)33)29-20(17)34-14-6-4-5-13(9-14)21(31)30(2)3/h4-10H,1-3H3,(H3,24,25)(H,32,33)(H,26,27,28,29) |
| InChIKey | CCFCMICWRNFIPH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 180.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|