C37H33N7O5 — CID 18916693
benzyl 2-[9-benzyl-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-2-yl]oxy-4-carbamimidoylbenzoate (PubChem CID 18916693) has the molecular formula C37H33N7O5 and a molecular weight of 655.72 g/mol. Its IUPAC name is benzyl 2-[9-benzyl-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-2-yl]oxy-4-carbamimidoylbenzoate.
| Compound Name | benzyl 2-[9-benzyl-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-2-yl]oxy-4-carbamimidoylbenzoate |
|---|---|
| PubChem CID | 18916693 |
| Molecular Formula | C37H33N7O5 |
| Molecular Weight | 655.72 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | benzyl 2-[9-benzyl-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-2-yl]oxy-4-carbamimidoylbenzoate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)OCc2ccccc2)c(Oc2nc(Oc3cccc(C(=O)N(C)C)c3)c3nc(C)n(Cc4ccccc4)c3n2)c1 |
| InChI | InChI=1S/C37H33N7O5/c1-23-40-31-33(44(23)21-24-11-6-4-7-12-24)41-37(42-34(31)48-28-16-10-15-27(19-28)35(45)43(2)3)49-30-20-26(32(38)39)17-18-29(30)36(46)47-22-25-13-8-5-9-14-25/h4-20H,21-22H2,1-3H3,(H3,38,39) |
| InChIKey | JYGCYDLBLSFZSS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 158.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|