C31H28N6O4 — CID 18916791
tert-butyl 3-[6-(3-amino-4-cyanophenoxy)-9-benzyl-8-methylpurin-2-yl]oxybenzoate (PubChem CID 18916791) has the molecular formula C31H28N6O4 and a molecular weight of 548.60 g/mol. Its IUPAC name is tert-butyl 3-[6-(3-amino-4-cyanophenoxy)-9-benzyl-8-methylpurin-2-yl]oxybenzoate.
| Compound Name | tert-butyl 3-[6-(3-amino-4-cyanophenoxy)-9-benzyl-8-methylpurin-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 18916791 |
| Molecular Formula | C31H28N6O4 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | tert-butyl 3-[6-(3-amino-4-cyanophenoxy)-9-benzyl-8-methylpurin-2-yl]oxybenzoate |
| SMILES | Cc1nc2c(Oc3ccc(C#N)c(N)c3)nc(Oc3cccc(C(=O)OC(C)(C)C)c3)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C31H28N6O4/c1-19-34-26-27(37(19)18-20-9-6-5-7-10-20)35-30(36-28(26)39-24-14-13-22(17-32)25(33)16-24)40-23-12-8-11-21(15-23)29(38)41-31(2,3)4/h5-16H,18,33H2,1-4H3 |
| InChIKey | AUEJDIPOQASLJD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|