About tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene
tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene (PubChem CID 146196756) has the molecular formula C25H34O5
and a molecular weight of 414.54 g/mol. Its IUPAC name is tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene.
Molecular Properties
| Compound Name | tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene |
| PubChem CID | 146196756 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene |
| SMILES | CC(C)(C)OOC(=O)c1cccc(C(=O)OC(C)(C)C)c1.CCCc1ccccc1 |
| InChI | InChI=1S/C16H22O5.C9H12/c1-15(2,3)19-13(17)11-8-7-9-12(10-11)14(18)20-21-16(4,5)6;1-2-6-9-7-4-3-5-8-9/h7-10H,1-6H3;3-5,7-8H,2,6H2,1H3 |
| InChIKey | UOJRBAGJYYPPRM-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene?
The IUPAC name of tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene (CID 146196756) is tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene.
What is the SMILES notation for tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene?
The canonical SMILES for tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene is CC(C)(C)OOC(=O)c1cccc(C(=O)OC(C)(C)C)c1.CCCc1ccccc1.
What is the InChIKey of tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene?
The InChIKey is UOJRBAGJYYPPRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O5.C9H12/c1-15(2,3)19-13(17)11-8-7-9-12(10-11)14(18)20-21-16(4,5)6;1-2-6-9-7-4-3-5-8-9/h7-10H,1-6H3;3-5,7-8H,2,6H2,1H3.
What are the key properties of tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene?
tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene has a molecular weight of 414.54 g/mol, XLogP of 6.17, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-tert-butylperoxycarbonylbenzoate;propylbenzene is sourced from PubChem (CID 146196756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).