C31H31N7O4 — CID 70098273
butyl 3-[6-(3-amino-4-carbamimidoylphenoxy)-9-benzyl-8-methylpurin-2-yl]oxybenzoate (PubChem CID 70098273) has the molecular formula C31H31N7O4 and a molecular weight of 565.63 g/mol. Its IUPAC name is butyl 3-[6-(3-amino-4-carbamimidoylphenoxy)-9-benzyl-8-methylpurin-2-yl]oxybenzoate.
| Compound Name | butyl 3-[6-(3-amino-4-carbamimidoylphenoxy)-9-benzyl-8-methylpurin-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 70098273 |
| Molecular Formula | C31H31N7O4 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | butyl 3-[6-(3-amino-4-carbamimidoylphenoxy)-9-benzyl-8-methylpurin-2-yl]oxybenzoate |
| SMILES | [H]/N=C(\N)c1ccc(Oc2nc(Oc3cccc(C(=O)OCCCC)c3)nc3c2nc(C)n3Cc2ccccc2)cc1N |
| InChI | InChI=1S/C31H31N7O4/c1-3-4-15-40-30(39)21-11-8-12-22(16-21)42-31-36-28-26(35-19(2)38(28)18-20-9-6-5-7-10-20)29(37-31)41-23-13-14-24(27(33)34)25(32)17-23/h5-14,16-17H,3-4,15,18,32H2,1-2H3,(H3,33,34) |
| InChIKey | WYXYICJTRWTAAM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 164.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|