C31H28ClN7O5 — CID 18916651
2-[2-(5-carbamimidoyl-2-chlorophenoxy)-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-9-yl]-3-phenylpropanoic acid (PubChem CID 18916651) has the molecular formula C31H28ClN7O5 and a molecular weight of 614.06 g/mol. Its IUPAC name is 2-[2-(5-carbamimidoyl-2-chlorophenoxy)-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-9-yl]-3-phenylpropanoic acid.
| Compound Name | 2-[2-(5-carbamimidoyl-2-chlorophenoxy)-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-9-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18916651 |
| Molecular Formula | C31H28ClN7O5 |
| Molecular Weight | 614.06 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 2-[2-(5-carbamimidoyl-2-chlorophenoxy)-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-9-yl]-3-phenylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(Cl)c(Oc2nc(Oc3cccc(C(=O)N(C)C)c3)c3nc(C)n(C(Cc4ccccc4)C(=O)O)c3n2)c1 |
| InChI | InChI=1S/C31H28ClN7O5/c1-17-35-25-27(39(17)23(30(41)42)14-18-8-5-4-6-9-18)36-31(44-24-16-19(26(33)34)12-13-22(24)32)37-28(25)43-21-11-7-10-20(15-21)29(40)38(2)3/h4-13,15-16,23H,14H2,1-3H3,(H3,33,34)(H,41,42) |
| InChIKey | QAALHCGXLRSSFS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 169.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.06 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|